Phương pháp giải những dạng bài bác tập chương Hidrocacbon ko no

Với cách thức giải các dạng bài xích tập chương Hidrocacbon ko no Hoá học tập lớp 11 tổng hợp những dạng bài bác tập, bài tập trắc nghiệm tất cả lời giải chi tiết với đầy đủ phương thức giải, ví dụ như minh họa sẽ giúp học sinh ôn tập, biết cách làm dạng bài bác tập chương Hidrocacbon ko no từ kia đạt điểm cao trong bài bác thi môn Hoá học tập lớp 11.

Bạn đang xem: Các dạng bài tập anken

*

Bài tập trắc nghiệm

Bài tập tính chất hóa học của Anken, Ankađien, Ankin

Bài 1: Theo quy tắc cộng Maccopnhicop, propen phản nghịch ứng cùng với HCl, thu được sản phẩm chính là

A. 1-Clpropan B. propan

C. 2-Clopropan D. 1,2-điClopropan.

Hiển thị đáp án

Đáp án: C

Bài 2: chất nào dưới đây làm mất thuốc nước brom?

A. propan B. metan C. propen D. cacbonđioxit

Hiển thị đáp án

Đáp án: C

Anken làm mất đi màu nước brom cho nên vì vậy người ta sử dụng nước brom hoặc dd brom trong CCl4 có tác dụng thuốc thử nhận thấy anken

Bài 3: Hiđro hóa trọn vẹn buta-1,3-đien, nhận được

A. butan B. isobutan

C. isopentan D. pentan

Hiển thị đáp án

Đáp án: A

Bài 4: lựa chọn câu trả lời đúng :

A. Anken là đa số hydrocacbon cơ mà phân tử tất cả chứa một link đôi C=C

B. Anken là phần đông hydrocacbon nhưng CTPT tất cả dạng CnH2n, n ≥ 2, nguyên.

C. Anken là những hydrocacbon không no bao gồm CTPT CnH2n, n ≥ 2, nguyên.

D. Anken là những hydrocacbon mạch hở mà phân tử tất cả chứa một liên kết đôi C=C

Hiển thị đáp án

Đáp án: D

Bài 5: Điều kiện để anken bao gồm đồng phân hình học?

A. từng ngtử cacbon ở link đôi liên kết với 1 ngtử hoặc đội ngtử như thể nhau.

B. mỗi ngtử cacbon ở links đôi liên kết với 2 ngtử hoặc đội ngtử khác nhau.

C. mỗi ngtử cacbon ở link đôi link với 2 ngtử hoặc team ngtử tương đương nhau.

D. từng ngtử cacbon ở liên kết đôi liên kết với cùng một ngtử hoặc đội ngtử khác nhau.

Hiển thị đáp án

Đáp án: B

Bài 6: Áp dụng phép tắc Maccopnhicop vào trường thích hợp nào dưới đây ?

A. bội nghịch ứng cộng của Br2 cùng với anken đối xứng.

C. bội phản ứng cùng của HX vào anken đối xứng.

B. bội nghịch ứng trùng thích hợp của anken.

D. phản nghịch ứng cùng của HX vào anken bất đối xứng.

Hiển thị đáp án

Đáp án: D

Bài 7: Monome của thành phầm trùng hợp mang tên gọi là polipropilen (P.P) là:

A. (- CH2-CH2-)n B. (-CH2(CH3)-CH-)n

C. CH2 =CH2 D. CH2=CH-CH3

Hiển thị đáp án

Đáp án: D

Bài 8: kết luận nào sau đấy là không đúng ?

A. Ankađien là phần đông HRC ko no mạch hở, phân tử gồm hai link đôi C=C

B. Ankađien có công dụng cộng thích hợp hai phân tử hiđro.

C. số đông hợp chất có khả năng cộng thích hợp hai phân tử hiđro thuộc loại ankađien.

D. phần lớn hiđrocacbon không no mạch hở, phân tử tất cả hai links đôi bí quyết nhau một link đơn được điện thoại tư vấn là ankađien liên hợp.

Hiển thị đáp án

Đáp án: C

Bài 9: cao su đặc buna là thành phầm có thành phần chính là polime thu được từ quá trình

A. Trùng hợp butilen, xúc tác natri.

B. Trùng đúng theo buta –1,3– đien, xúc tác natri.

C. Polime hoá cao su đặc thiên nhiên.

D. Đồng trùng thích hợp buta –1,3– đien với natri.

Hiển thị đáp án

Đáp án: B

Bài 10: hóa học nào không tính năng với dung dịch AgNO3/NH3 ?

A. But-1-in B. But-2-in C. Etin D. Propin

Hiển thị đáp án

Đáp án: B

Akin gồm nối 3 đầu mạch mới tác dụng với dung dịch AgNO3/NH3

Bài 11: Công thức tổng thể của Anken là:

A. CnH2n+2(n ≥ 0) B.CnH2n(n ≥ 2)

C. CnH2n (n ≥ 3) D.CnH2n-6(n ≥ 6)

Hiển thị đáp án

Đáp án: B

Bài 12: đến phản ứng thân buta-1,3-đi en và HBr ngơi nghỉ -80°C (tỉ lệ mol 1 : 1), thành phầm chính của bội phản ứng là

A. CH3CHBrCH=CH2 B. CH3CH=CHCH2Br

C. CH2BrCH2CH=CH2 D.CH2CH=CBr CH3

Hiển thị đáp án

Đáp án: A

Bài 13: Số liên kết σ trong một phân tử buta-1,2- đien là

A.8 B. 7 C. 6

Hiển thị đáp án

Đáp án: D

Bài 14: Trùng vừa lòng eten, sản phẩm thu được có cấu trúc là:

A. (-CH2=CH2-)n . B. (-CH2-CH2-)n.

C. (-CH=CH-)n . D. (-CH3-CH3-)n .

Hiển thị đáp án

Đáp án: B

Bài 15: nhựa P.E(polietilen) được pha chế trực tiếp từ chất nào sau đây?

A. C2H2 B. C2H4 C. C2H6 D. Ý con kiến khác

Hiển thị đáp án

Đáp án: B

Bài 16: kết luận nào sau đó là đúng?

A. Ankađien có công thức phân tử dạng CnH2n–2.

B. các hiđrocacbon gồm công thức phân tử dạng CnH2n–2 gần như thuộc nhiều loại ankađien.

C. Ankađien không tồn tại đồng phân hình học.

D. Ankađien phân tử khối khủng không công dụng với brom (trong dung dịch).

Hiển thị đáp án

Đáp án: A

Bài 17: mang lại phản ứng giữa buta-1,3-đien với HBr sinh hoạt -80ºC (tỉ lệ mol 1:1), thành phầm chính của bội nghịch ứng là

A. CH3CHBrCH=CH2. B. CH3CH=CHCH2Br.

C. CH2BrCH2CH=CH2. D. CH3CH=CBrCH3.

Hiển thị đáp án

Đáp án: A

Bài 18: kết luận nào sau đó là không đúng ?

A. Buta–1,3–đien cùng đồng đẳng gồm công thức phân tử chung CxH2x–2 (x ≥ 3).

B. các hiđrocacbon có công thức phân tử dạng CxH2x–2 cùng với x ≥ 3 đông đảo thuộc hàng đồng đẳng của ankađien.

C. Buta–1,3–đien là một ankađien liên hợp.

D. Trùng thích hợp buta–1,3–đien (có natri làm cho xúc tác) được cao su thiên nhiên buna.

Hiển thị đáp án

Đáp án: B

Bài 19: Hidro hóa trọn vẹn axetilen bằng lượng dư hidro tất cả xúc tác Ni với đun lạnh thu được thành phầm là?

A. Etylen B. etan C. eten D. etyl

Hiển thị đáp án

Đáp án: B

Bài 20: khi hidro hoá but-2-in bằng lượng H2 dư cùng với xúc tác là Pd/PbCO3 cho thành phầm chính là:

A. butan B. trans-but-2-en C. Cis-but-2-en D. cả B và C

Hiển thị đáp án

Đáp án: D

Dạng bài xích tập Đồng phân, danh pháp của Anken, Ankađien, Ankin

A. Bài bác tập từ bỏ luận

Bài 1: Viết các đồng phân cấu tạo và gọi tên anken C5H10.

Hướng dẫn:

Các đồng phân kết cấu anken của C5H10:

CH2=CH-CH2CH2-CH3 (pent-1-en)

CH3CH=CHCH2-CH3 (pent-2-en)

CH2=CH-CH(CH3)-CH3 (3-metylbut-2-en)

CH2=C(CH2)CH2-CH3 (2-metylbut-1-en)

CH3CH=CH(CH3)-CH3 (2-metylbut-2-en)

Bài 2: cho các chất : 2-metylbut-1-en (1); 3,3-đimetylbut-1-en (2); 3-metylpent-1-en (3); 3-metylpent-2-en (4); 3-metylbut-2-en (5). Viết CTCT của những chất. Số đông chất làm sao là đồng phân của nhau ?

Hướng dẫn:

(1) CH2=C(CH2)CH2-CH3

(2) CH2=CH-C(CH3)2-CH3

(3) CH2=CH-CH(CH3)CH2-CH3

(4) CH3CH=C(CH3)CH2-CH3

(5) CH2=CH-CH(CH3)-CH3

Các hóa học là đồng phân của nhau là: (1) cùng (5); (2), (3) và (4) .

Bài 3: Viết những đồng phân ankađien liên hợp của C5H8? điện thoại tư vấn tên những đồng phân.

Hướng dẫn:

Các đồng phân phối hợp của C5H8:

CH2=CH-CH=CH-CH3 (penta-1,3-đien)

CH2=C(CH3)-CH=CH2 (2-metylpenta-1,3-đien)

Bài 4: Viết CTCT của các chất sau: (1) Buta-1,3-đien, (2) isopren (3) 2,3-đimetylpenta-1,3-đien.

Hướng dẫn:

(1) CH2=CH-CH=CH2 ;

(2) CH2=C(CH3)-CH=CH2;

(3) CH2=C(CH3)-C(CH3)=CH-CH3

Bài 5: Viết các đồng phân ankin của C4H6 và điện thoại tư vấn tên. Cho những đồng phân kia với nước brom dư; hiđro dư (xt theo thứ tự là Ni) với AgNO3 trong hỗn hợp NH3 viết PTHH xảy ra.

Hướng dẫn:

Các đồng phân ankin của C4H6 là:

CH≡C-CH2-CH3 (but-1-in); CH3-C≡C-CH3 (but-2-in)

Phương trình làm phản ứng:

CH≡C-CH2-CH3 + Br2 → CHBr2-CBr2-CH2-CH3

CH≡C-CH2-CH3 + H2 → CH3-CH2-CH2-CH3

CH≡C-CH2-CH3 + AgNO3 + NH3 → CAg≡C-CH2-CH3 + NH4NO3

CH3-C≡C-CH3+ Br2 → CH3-CBr2-CBr2-CH3

CH3-C≡C-CH3 + H2 → CH3-CH2-CH2-CH3

Bài 6: Viết CTCT các ankin mang tên sau: (1) iso-butylaxetilen, (2) metyl iso-propylaxetilen, (3) 3-metylpen-1-in, (4) 2,2,5,5-tetrametylhex-3-in, (5) xicl-clopropylaxetilen.

Hướng dẫn:

(1) (CH3)2-CH-CH2-C≡CH

(2) CH3-C≡C-CH(CH3)2

(3) CH≡C-CH(CH3)-CH2-CH3

(4) CH3-C(CH3)2-C≡C-C(CH3)2-CH3

(5)

*

B. Bài xích tập trắc nghiệm

Bài 1: thương hiệu theo danh pháp nước ngoài của hóa học (CH3)2CHCH=CHCH3 là:

A.1-Metyl-2-isopropyleten B.1,1-Đimetylbut-2-en

C. 1-Isopropylpropen D.4-Metylpent-2-en.

Lời giải:

Đáp án: D

Bài 2: Hợp hóa học C5H10 có bao nhiêu đồng phân anken ?

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: D

5 đồng phân kết cấu và 2 đồng phân cis – trans

Bài 3: Anken gồm đồng phân hình học ?

A.Pent-1-en. B. Pent-2-en.

C. 2-metylbut-2-en. D. 3-metylbut-1-en.

Lời giải:

Đáp án: B

CTCT: CH3CH=CHCH2-CH3

Bài 4: cho các chất sau:

(1) CH2=CHCH2CH2CH=CH2; (2) CH2=CHCH=CHCH2CH3;

(3) CH3C(CH3)=CHCH2;(4) CH2=CHCH2CH=CH2;

(5) CH3CH2CH=CHCH2CH3;(6) CH3C(CH3)=CH2;

(7) CH3CH2C(CH3)=C(C2H5)CH(CH3)2; (8) CH3CH=CHCH3.

Số chất có đồng phân hình học là:

A. 4. B. 1. C. 2. D. 3.

Lời giải:

Đáp án: A

2,5,7,8

Bài 5: Số đồng phân cấu trúc thuộc một số loại ankađien ứng với phương pháp phân tử C5H8 là:

A. 4. B. 5. C. 6. D. 7.

Lời giải:

Đáp án: B

Bài 6: Ankađien X có CTCT: CH3-CH=CH-CH(CH3)-CH=CH2. X mang tên thay cố gắng là.

A. 4-metylhexa-2,5-đien B. 3-metylhexa-1,4-đien

C. 3-metylhexa-2,4-đien D. A, B, C hầu hết sai.

Lời giải:

Đáp án: B

Bài 7: Hợp hóa học CH3CH=CHC(CH3)2CH=CH2 mang tên thay thế là:

A. 4,4-đimetylhexa-2,4-đien B. 3,3-đimetylhexa-1,4-đien

C. 3,4-đimetylhexa-1,4-đien D. 4,5-đimetylhexa-2,4-đien.

Lời giải:

Đáp án: B

Bài 8: Ankađien Z có tên thay thế: 2,3-đimetylpenta-1,3-đien. Vậy CTCT của Z là

A. CH2=C(CH3)-CH(CH3)-CH=CH2

B. CH2=C(CH3)-C(CH3)=CH-CH3

C. CH2=C=C(CH3)-CH(CH3)-CH2

D. CH2=C(CH3)-CH2-C(CH3)=CH2

Lời giải:

Đáp án: B

Bài 9: C5H8 tất cả số đồng phân ankin là:

A. 1 B. 2 C. 3 D. 4

Lời giải:

Đáp án: C

Bài 10: đến hợp chất hữu cơ tất cả CTCT CH≡C-CH(CH3)2 mang tên gọi là:

A. 2-metylbutin B. isopropyl axetilen C. 3-metylbut-1-in D. B hoặc C

Lời giải:

Đáp án: C

Bài 11: Tên thường thì của hợp chất có công thức : CH3 – C ≡ C – CH3 là

A. đimetylaxetilen B. but -3 –in C. but -3 –en D. but-2 –in.

Lời giải:

Đáp án: A

Bài 12: mang lại công thức kết cấu của hợp chất sau: CH3-C≡C-CH2-C(Cl)(CH3)-CH3?

Tên hotline đúng theo danh pháp IUPAC của hợp hóa học trên là:

A. 2 - clo - 2 - metylhex - 4 - in. B. 5 - clo - 5 - metylhex - 2 - in.

C. 2 - metyl - 2 - clohex - 4 - in. D. 5 - metyl - 5 - clohex - 2 - in.

Lời giải:

Đáp án: B

Bài 13: call tên hiđrocacbon tất cả công thức kết cấu sau:

*

A. 6, 7 - đimetyloct - 4 - in. B. 2 - isopropylhept - 3 - in.

C. 2, 3 - đimetyloct - 4 - in. D. 6 - isopropylhept - 4 -in.

Lời giải:

Đáp án: C

Bài 14: Đimetylaxetilen mang tên gọi là

A. propin B. but-1-in C. but-2-in D. but-2-en

Lời giải:

Đáp án: C

Phản ứng cùng của Anken, Ankađien, Ankin

A. Phương thức giải & Ví dụ minh họa

a/ Anken

Lý thuyết và phương pháp giải

*Cộng Br2: CnH2n + Br2 → CnH2nBr2

- Anken : Br2 = 1 : 1 ( tỉ lệ thành phần về số mol hoặc thể tích )

- khối lượng của bình tăng lên là cân nặng của hidrocabon không no bị hấp thụ.

- phản nghịch ứng cộng HX của anken tuân theo nguyên tắc macopnhicop.

*Cộng H2: CnH2n + H2 → CnH2n + 2

- Tỉ lệ phản nghịch ứng luôn là 1:1

- khối lượng trước và sau làm phản ứng luôn bằng nhau

- Số mol sau làm phản ứng luôn giảm ( bởi vì mất H2 ) → nH2 pư = nđ - ns

Ví dụ minh họa

Bài 1: Dẫn 3,36 lít các thành phần hỗn hợp X có 2 anken là đồng đẳng tiếp đến vào bình nước brom dư, thấy cân nặng bình tạo thêm 7,7 gam. Tra cứu CTPT của 2 anken ?

Hướng dẫn:

Số mol tất cả hổn hợp X là: nX = 3,36/22,4 = 0,15 mol

Phương trình bội nghịch ứng:

*

Khối lượng bình brom tăng là cân nặng của 2 anken: mX = 7,7 gam

*

Vậy CTPT của 2 anken kế tiếp là: C3H6 cùng C4H8

Bài 2: Dẫn thư thả 6,72 lit (đktc) tất cả hổn hợp X có etilen cùng propilen và dung dịch brom, dung dịch brom bị nhạt màu, và không có khí bay ra. Cân nặng dung dịch sau bội phản ứng tắng 9,8 gam. Thành phần tỷ lệ theo thể tích của etilen trong X là

Hướng dẫn:

*

Bài 3: mang đến 4,48 lit các thành phần hỗn hợp X tất cả etan, propan với propen qua hỗn hợp brom dư, thấy khối lượng bình brom tăng 4,2 gam. Lượng khí sót lại thoát thoát khỏi dung dịch rước đốt cháy hoàn toàn thu được 6,48 gam nước. Tính % thể tích những chất tất cả trong láo hợp.

Hướng dẫn:

Số mol tất cả hổn hợp X là : nX = 4,48/22,4 = 0,2 mol

Khối lượng bình brom tăng là khối lượng của propen: mpropen = 4,2 gam ⇒ npropen = 4,2/ 42 = 0,1 mol

Phương trình làm phản ứng: C3H6 + Br2 → C3H6Br2

Khí bay ra gồm: C2H6 với C3H8.

Phương trình phản nghịch ứng đốt cháy C2H6 cùng C3H8

C2H6 + 7/2 O2 −tº→ 2CO2 + 3H2O

C3H8 + 5O2 −tº→ 3CO2 + 4H2O

nH2O = 6,48/18=0,36 mol

Gọi số mol của etan với propan thứu tự là x với y mol

Ta cóx + y = 0,2 – 0,1 = 0,1 (1); 3x + 4 y = 0,36 (2)

Từ (1), (2) ⇒ x = 0,04 và y = 0,06.

Phần trăm thể tích mỗi khí trong lếu láo hợp ban đầu là:

%Vetan = 0,04/0,2.100% = 20%; %Vpropan = 0,06/0,2.100% = 30%; %Vpropen = 0,1/0,2.100% = 50%

Bài 4: các thành phần hỗn hợp khí X bao gồm H2 và một anken có tác dụng cộng HBr cho thành phầm hữu cơ duy nhất. Tỉ khối của X so với H2 bằng 9,1. Đun lạnh X gồm xúc tác Ni, sau khi phản ứng xẩy ra hoàn toàn, thu được tất cả hổn hợp khí Y không làm mất màu nước brom; tỉ khối của Y so với H2 bởi 13. Tìm kiếm công thức cấu trúc của anken.

Hướng dẫn:

Gọi số mol hổn phù hợp X là 1mol

Ta bao gồm Mtb X = 9,1. 2 = 18,2 ⇒ mX = 18,2. 1 = 18,2 g = mY

mà Mtb Y = 13. 2 = 26 ⇒ nY = 18,2/26= 0,7 mol

⇒ nH2 pư = 1 – 0,7 = 0,3 mol = nanken ⇒ nH2 bđ = 0,7 mol

Manken = (18,2 - 0,7.2)/0,3 = 14n ⇒ n = 4 ⇒ CTPT của anken là C4H8

Bài 5: các thành phần hỗn hợp khí X bao gồm H2 và C2H4 tất cả tỉ khối đối với He là 3,75. Dẫn X qua Ni nung nóng, thu được hỗn hợp khí Y tất cả tỉ khối so với He là 5. Tính công suất của bội phản ứng hiđro hoá?

Hướng dẫn:

Ta bao gồm : Mtb X = 4. 3,75 = 15

*

Vậy năng suất tính theo anken hoặc H2 cũng được

Giả sử: nX = 1mol ⇒ mX = 15. 1 = 15 g = mY

Mà Mtb Y = 5. 4 = đôi mươi ⇒ nY = 15/20 = 0,75 mol ⇒ nH2 pư= 1 – 0,75 = 0,25 mol

⇒ H = 0,25/0,5.100% = 50 %

b/ Akadien và Akin

Lý thuyết và cách thức giải

Giả sử X là láo lếu hợp ban sơ gồm CnH2n-2 cùng H2; Y là lếu hợp các chất sau p/ư

+ những phản ứng xảy ra:

CnH2n-2 + H2 → CnH2n.

CnH2n-2 + 2H2 → CnH2n+2.

+ hỗn hợp Y có thể có: CnH2n, CnH2n+2, CnH2n-2 cùng H2 dư

+ quan hệ nam nữ về khối lượng, ta có: mA = mB

+ quan hệ về số mol, ta có: nA– nB= nH2 bội nghịch ứng

+ Đốt cháy B cũng là đốt cháy A.

Ví dụ minh họa

Bài 1: cho m gam buta-1,3-đien tính năng vừa hết với (m - 17,5) gam H2 chiếm được a gam sản phẩm cộng

a. Tính cực hiếm của m ?

b. giá trị của a là từng nào ?

Hướng dẫn:

CH2=CH-CH=CH2 + 2H2 → CH3-CH2-CH2CH3

a. Số mol buta-1,3-đien: n1 = m/54 mol

Số mol H2 làm phản ứng: nH2 = (m-17,5)/2 mol

Theo phương trình làm phản ứng: 2n1 = nH2 ⇔ 2m/54 = (m-17,5)/2 ⇒ m = 18,9 gam

b. giá trị của a là:

a = m + m – 17,5 = 20,3 gam

Bài 2: Một hỗn hợp X bao gồm 0,12 mol C2H2 với 0,18 mol H2. Mang đến X trải qua Ni nung nóng, sau một thời gian thu được hỗn hợp khí Y. đến Y vào trong bình đựng brom dư, thấy bình brom tăng m gam và thoát ra khí Z. Đốt cháy hết Z cùng cho toàn bộ sản phẩm cháy vào trong bình đựng dung dịch Ca(OH)2 dư thấy bao gồm 5 gam kết tủa mở ra và thấy cân nặng dung dịch giảm 1,36 gam. Tính quý giá của m ?

Hướng dẫn:

Khối lượng hỗn hợp X: mX = 0,12.26 + 0,18.2 = 3,48 g

Cho X trải qua Ni nung nóng:

Phương trình làm phản ứng: C2H2 + H2 → C2H4; C2H2 + 2H2 → C2H6

Hỗn thích hợp Y gồm: C2H2, C2H4, C2H6 cùng H2

Cho Y qua bình đựng Br2 dư có C2H2, C2H4 bị duy trì lại. Tất cả hổn hợp Z gồm: C2H6 với H2

Phương trình phản nghịch ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Đốt cháy Z thu được CO2 và H2O:

nCO2 = nCaCO3 = 0,05 mol.

mdd bớt = m↓ - (mH2O + mCO2) ⇒ mH2O = 5 - 1,36 – 0,05.44 = 1,44 g

Số mol H2O: nH2O = 1,44/18 = 0,08 mol ⇒ mZ = 0,08.2 + 0,05.12 = 0,76 g

Khối lượng bình brom tăng: m = mX - mZ = 3,48 – 0,76 = 2,72 g

Bài 3: hỗn hợp X có 0,15 mol CH4; 0,09 mol C2H2 với 0,2 mol H2. Nung lạnh X cùng với xúc tác Ni thu được tất cả hổn hợp Y. Mang đến Y qua dung dịch brom dư thu được các thành phần hỗn hợp khí Z (có tỉ khối đối với He là 4). Biết bình brom tăng 0,82 gam. Tính % thể tích của C2H6 trong tất cả hổn hợp Z.

Hướng dẫn:

Nung lạnh X cùng với Ni thu được hỗn hợp Y gồm: C2H2, C2H4, C2H6, CH4, H2

Cho Y qua bình brom: C2H2, C2H4 bị giữ lại. Các thành phần hỗn hợp khí Z: C2H6, CH4, H2

Phương trình phản nghịch ứng: C2H4 + Br2 → C2H4Br2; C2H2 + 2Br2 → C2H2Br4

Khối lượng của hỗn hợp X: mX = 0,15.16 + 0,09.26 + 0,2.2 = 5,14 g

Khối lượng của hỗn hợp Z : mZ = 5,14 – 0,82 = 4,32 g ⇒ nZ = 4,32/16 = 0,27 mol

nH2+C2H6 = 0,27 – 0,15 = 0,12 mol

Gọi số mol của H2 và C2H6 theo thứ tự là: x với y ta có: x + y = 0,12 mol

2x + 30 y + 16.0,15 = 4,32 ⇒ x + 15 y = 0,96 ⇒ x = 0,06 cùng y = 0,06

% thể tích của C2H6 trong hỗn hợp Z: %VC2H6 = 0,06.100%/0,27 = 22,22%

B. Bài bác tập trắc nghiệm

Bài 1: Dẫn 0,2 mol một olefin A qua dung dịch brom dư, trọng lượng bình sau phản bội ứng tăng 5,6 gam.Vậy phương pháp phân tử của A là:

A. C2H4 B. C3H6 C. C4H8 D. C5H10

Lời giải:

Đáp án: A

*

MX = 5,6/0,2 = 28 ⇒ n = 2

Bài 2: mang lại V lít một anken A làm việc đkc qua chai nước brom dư, có 8 g Br2 sẽ phản ứng đồng thời cân nặng bình tăng 2,8g. Còn mặt khác khi cho A bội nghịch ứng cùng với HBr chỉ thu được một loại sản phẩm . Quý giá của V và tên của A là:

A. 2,24 lít; propen B. 2,24 lít; etilen

C. 1,12 lít; but-1-en D. 1,12 lít; but-2-en

Lời giải:

Đáp án: D

CTPT A : CnH2n ; mãng cầu = nBr2 = 8/160 = 0,05 mol; MA = 2,8/0,05 = 56 ⇒ n = 4;

A bội phản ứng Br2 cho 1sản phẩm ⇒ A có cấu tạo đối xứng.

Bài 3: Một tất cả hổn hợp X rất có thể tích 11,2 lít (đktc), X có 2 anken đồng đẳng kế tiếp nhau. Khi cho X qua nước Br2 dư thấy cân nặng bình Br2 tăng 15,4g. Xác định CTPT và số mol từng anken trong các thành phần hỗn hợp X.

A. 0,2 mol C2H4 cùng 0,3 mol C3H6 B. 0,2 mol C3H6 cùng 0,2 mol C4H8

C. 0,4 mol C2H4 với 0,1 mol C3H6 D. 0,3 mol C2H4 cùng 0,2 mol C3H6

Lời giải:

Đáp án: C

*

nX = 11,2/ 22,4 = 0,5 mol; mX = 15,4 gam

Mtb X = mX/nX = 15,4/0,5 = 30,8 ⇒ ntb = 2,2. 2

⇒ anken là: C2H4 với C3H6; nC2H4 : nC3H6 = 4:1

⇒ nC2H4 = 0,4 mol cùng nC3H6 = 0,1 mol

Bài 4: cho 10g các thành phần hỗn hợp khí X bao gồm etilen cùng etan qua dung dịch Br2 25% bao gồm 160g dd Br2 bội nghịch ứng. % khối lượng của etilen trong các thành phần hỗn hợp là:

A. 70% B. 30% C. 35,5% D. 64,5%

Lời giải:

Đáp án: A

nC2H4 = nBr2 = 25.160/100.160 = 0,25 mol ⇒ %mC2H4 = 0,25.28/10.100% = 70%

Bài 5: lúc cho tất cả hổn hợp A tất cả anken và H2 đi qua xúc tác Ni nung lạnh thu được tất cả hổn hợp B. Điều xác minh nào sau đây là đúng?

A. na B B. na – nB = nH2 pư C. MA = MB D. mA > mB

Lời giải:

Đáp án: B

Bài 6: các thành phần hỗn hợp khí X bao gồm 0,3 mol H2 với 0,1 mol propen. Nung X một thời hạn với xúc tác Ni thu được tất cả hổn hợp khí Y có tỉ khối so với H2 là 16. Tính số mol H2 làm phản ứng?

A. 0,15 mol B. 0,2 mol C. 0,25 mol D. 0,3 mol

Lời giải:

Đáp án: C

mX = 0,3.2 + 0,1.42 = 4,8 g ⇒ nY = 4,8/32 = 0,15 mol; nH2 pư = 0,4 – 0,15 = 0,25 mol

Bài 7: tất cả hổn hợp X tất cả H2, C2H4 với C3H6 bao gồm tỉ khối so với H2 là 9,25. đến 22,4 lít X (đktc) vào bình bí mật có sẵn một ít bột Ni. Đun nóng bình một thời gian, thu được hỗn hợp khí Y bao gồm tỉ khối đối với H2 bằng 10. Toàn bô mol H2 vẫn phản ứng là

A. 0,070 mol B. 0,015 mol

C. 0,075 mol D. 0,050 mol

Lời giải:

Đáp án: C

mX = 18,5.1 = 18,5 g; nY = 18,5/20 = 0,925 mol ⇒ nH2 pư = 1 – 0,925 = 0,075 mol

Bài 8: các thành phần hỗn hợp khí X có hiđro cùng một anken. Nung rét 24,64 lít tất cả hổn hợp X (đktc), bao gồm Ni làm cho xúc tác. Sau phản bội ứng chiếm được 25,3 gam tất cả hổn hợp khí Y. Tỷ khối của X đối với H2 là:

A. 10,5 gam B. 11,5 gam C. 12 gam D. 12,5 gam

Lời giải:

Đáp án: B

nX = 26,64/22,4 = 1,1 mol; MX.nX = mX = mY ⇒ MX = 25,3/1,1 = 23; dX/H2 = 23/2 = 11,5

Bài 9: hỗn hợp khí A cất eilen cùng H2. Tỉ khối của A đối với hiđro là 7,5. Dẫn A đi qua chất xuc tác Ni nung rét thu được hh khí B có tỉ khối so với hiđro là 9,0. Hiệu suất phản ứng cộng hiđro của etilen là:

A. 33,3% B. 66,7% C. 25% D. 50%

Lời giải:

Đáp án: A

Mtb A = 2. 7,5 = 15

đưa sử mãng cầu = 1mol ⇒ mB = mA = 15. 1 = 15 g ; nC2H4 : nH2 = 1:1

mà lại Mtb B = 9. 2 = 18 ⇒ nB = 0,83 mol ⇒ nH2 pư = 1 – 0,83 = 0,167 mol

⇒ H = 0,176/0,5 .100% = 33,3%

Bài 10: Đun nóng 20,16 lít tất cả hổn hợp khí X có C2H4 cùng H2 dùng Ni xúc tác thì nhận được 13,44 lít tất cả hổn hợp khí Y. đến Y lội thật đủng đỉnh qua bình đựng dung dịch Br2 dư thì thấy trọng lượng bình tăng 2,8 gam. Năng suất phản ứng hidro hóa anken:

A. 40% B. 60% C. 65% D. 75%

Lời giải:

Đáp án: D

nX = 20,16/22,4 = 0,9 mol; nY = 13,44/22,4 = 0,6 mol; nH2 pư = 0,9 – 0,6 = 0,3 mol; nanken dư = 2,8/28 = 0,1 mol; nanken bđ = 0,1 + 0,3 = 0,4 mol ⇒ nH2 bđ = 0,5 mol ⇒ H = 0,3/0,4.100%=75%

Bài 11: mang lại H2 cùng 1 olefin có thể tích bằng nhau qua Niken đun nóng ta được hỗn hợp A. Biết tỉ khối khá của A so với H2 là 23,2. Năng suất phản ứng hiđro hoá là 75%. Công thức phân tử olefin là

A. C2H4. B. C3H6. C. C4H8. D. C5H10.

Lời giải:

Đáp án: C

mang sử nanken = nH2 = 1 mol; na = 2- 0,75 = 1,25 mol; Mđ = 23,2.2.1,25/2 = 14,5; 14.n + 2 = 2.14,5 ⇒ n = 4

Bài 12: 2,24 lít hỗn hợp X bao gồm buta–1,3–đien và penta–1–3-đien (đktc) tất cả thể tính năng hết buổi tối đa bao nhiêu lít dung dịch brom 0,10 M ?

A. 2l B. 3l C.2,5l D.4l

Lời giải:

Đáp án: A

nBr2 = 2nX = 0,2 mol ⇒ VBr2 = 0,2/0,1 = 2 lít

Bài 13: hóa học nào sau đây không buộc phải là sản phẩm cộng giữa dung dịch brom và isopren (theo tỉ lệ thành phần mol 1:1) ?

A. CH2BrC(CH3)BrCH=CH2. B. CH2BrC(CH3)=CHCH2Br.

C. CH2BrCH=CHCH2CH2Br. D. CH2=C(CH3)CHBrCH2Br.

Lời giải:

Đáp án: C

Bài 14: Ankađien A + brom (dd) CH3C(CH3)BrCH=CHCH2Br. Vậy A là

A. 2-metylpenta-1,3-đien. B. 2-metylpenta-2,4-đien.

C. 4-metylpenta-1,3-đien. D. 2-metylbuta-1,3-đien.

Lời giải:

Đáp án: C

Bài 15: đến but-1-in phản ứng cùng với H2 (theo tỉ trọng mol 1:1 và xúc tác Pd/PbCO3) thu được sản phẩm hữu cơ có tên là:

A. Butan B. But-2-en C. But-1-en D. A cùng C đều đúng.

Lời giải:

Đáp án: C

Bài 16: cho các chất hữu cơ :

CH2=CH–CH2–CH3 (M)

CH≡C–CH2–CH3 (N)

CH2=C=CH–CH3 (P)

CH2=CH–CH=CH2 (Q)

CH2=C(CH3)–CH3 (R)

Những chất cho cùng 1 sản phẩm cộng hiđro là:

A. M, N, P, Q B. M, N, R C. M, N, R D. Q, R

Lời giải:

Đáp án: A

Bài 17: đến m gam propin tính năng với H2 dư (Ni, tº) thu được (m + 8) gam thành phầm hữu cơ Y. Quý hiếm của m là:

A. 80 gam. B. 40 gam C. 160 gam D. 120 gam

Lời giải:

Đáp án: A

Bài 18: đến 3,12 gam ankin X bội phản ứng cùng với 0,1 mol H2 (xúc tác Pd/PbCO3, tº), thu được hỗn hợp Y chỉ tất cả hai hiđrocacbon. Phương pháp phân tử của X là

A. C2H2. B. C5H8. C. C4H6. D. C3H4.

Lời giải:

Đáp án: A

nankin > 0,1 mol; MX 2H2

Bài 19: tất cả hổn hợp X bao gồm C2H2 cùng H2 gồm cùng số mol. Mang một lượng tất cả hổn hợp X mang đến qua hóa học xúc tác nung nóng, thu được các thành phần hỗn hợp Y bao gồm C2H4, C2H6, C2H2 với H2. Sục Y vào dung dịch brom (dư) thì cân nặng bình brom tăng 10,8 gam và thoát ra 4,48 lít tất cả hổn hợp khí (đktc) gồm tỉ khối so với H2 là 8. Thể tích O2(đktc) buộc phải để đốt cháy trọn vẹn hỗn đúng theo Y là:

A. 33,6 lít. B. 22,4 lít. C. 44,8 lít. D. 26,88 lít.

Lời giải:

Đáp án: A

mX = 10,8 + 16.0,2 = 14 g

mX = mC2H2 + mH2 = 26x + 2x = 28x = 14 ⇒ x = 0,5 mol;

nO2 = 0,5nH2 + 2,5nC2H2 = 0,5 + 2,5.0,5 = 1,5 mol ⇒ V = 33,6 lít

Bài 20: Đun nóng các thành phần hỗn hợp khí bao gồm 0,06 mol C2H2 và 0,04 mol H2 với xúc tác Ni, sau một thời hạn thu được hỗn hợp khí Y. Dẫn cục bộ hỗn thích hợp Y lội thanh nhàn qua bình đựng hỗn hợp brom (dư) thì còn sót lại 0,448 lít tất cả hổn hợp khí Z (ở đktc) có tỉ khối so với O2 là 0,5. Cân nặng bình dung dịch brom tăng là:

A. 1,04 gam. B. 1,64 gam. C.

Xem thêm: Nhạclý #25 Quãng 8 - Central Vietnam'S Must

1,20 gam. D. 1,32 gam

Lời giải:

Đáp án: D

mY = 0,06.26 + 0,04.2 = 1,64 g; mZ = 0,02.16 = 0,32 g; m↑ = mY – mZ = 1,64 – 0,32 = 1,32